CAS 1357086-92-0 appears in our catalog under these names: 2,4-Dichloro-6-methyl-6H-pyrrolo(3,4-d)pyrimidine, 98%, 2,4-Dichloro-6-methyl-6H-pyrrolo[3,4-d]pyrimidine, >95%, >95%, 2,4-DICHLORO-6-METHYL-6H-PYRROLO[3,4-D]PYRIMIDINE, >95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
2,4-dichloro-6-methylpyrrolo[3,4-d]pyrimidine (CAS 1357086-92-0) is a chemical compound with the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. IUPAC name: 2,4-dichloro-6-methylpyrrolo[3,4-d]pyrimidine. InChIKey: NFNRZFJLXGDBDI-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2N3 |
|---|---|
| Molecular weight | 202.04 g/mol |
| IUPAC name | 2,4-dichloro-6-methylpyrrolo[3,4-d]pyrimidine |
| InChIKey | NFNRZFJLXGDBDI-UHFFFAOYSA-N |
| SMILES | CN1C=C2C(=C1)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)