Products 1357351-29-1
CAS 1357351-29-1 is the registry number for Nonin A. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
Methyl 6-hydroxy-2-(hydroxymethyl)-2-methylbenzo[h]chromene-5-carboxylate (CAS 1357351-29-1) is a chemical compound with the molecular formula C17H16O5 and a molecular weight of 300.30 g/mol. IUPAC name: methyl 6-hydroxy-2-(hydroxymethyl)-2-methylbenzo[h]chromene-5-carboxylate. InChIKey: IDZKIDTWFRCHKW-UHFFFAOYSA-N.
| Molecular formula | C17H16O5 |
|---|---|
| Molecular weight | 300.30 g/mol |
| IUPAC name | methyl 6-hydroxy-2-(hydroxymethyl)-2-methylbenzo[h]chromene-5-carboxylate |
| InChIKey | IDZKIDTWFRCHKW-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C3=CC=CC=C3C(=C2C(=O)OC)O)CO |
Computed by PubChem (NCBI)