Products 1357353-84-4
CAS 1357353-84-4 appears in our catalog under these names: 3-[Fluoro-(3-fluoro-phenyl)-methyl]-benzoic acid, 95%, 3–(Fluoro(3–fluorophenyl)methyl)benzoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
3-[fluoro-(3-fluorophenyl)methyl]benzoic acid (CAS 1357353-84-4) is a chemical compound with the molecular formula C14H10F2O2 and a molecular weight of 248.22 g/mol. IUPAC name: 3-[fluoro-(3-fluorophenyl)methyl]benzoic acid. InChIKey: MCHVFZRLUIOORC-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O2 |
|---|---|
| Molecular weight | 248.22 g/mol |
| IUPAC name | 3-[fluoro-(3-fluorophenyl)methyl]benzoic acid |
| InChIKey | MCHVFZRLUIOORC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C(C2=CC(=CC=C2)F)F |
Computed by PubChem (NCBI)