CAS 13576-51-7 is the registry number for 5-(4-Chlorophenyl)oxazol-2-amine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
5-(4-chlorophenyl)-1,3-oxazol-2-amine (CAS 13576-51-7) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 5-(4-chlorophenyl)-1,3-oxazol-2-amine. InChIKey: XVROYTBFOAFKGN-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1,3-oxazol-2-amine |
| InChIKey | XVROYTBFOAFKGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(O2)N)Cl |
Computed by PubChem (NCBI)