CAS 1357615-55-4 is the registry number for (E)-2-(3,3,3-Trifluoroprop-1-en-1-yl)aniline, 98%. Offered by: AmBeed. Available pack sizes: 5g.
2-[(E)-3,3,3-trifluoroprop-1-enyl]aniline (CAS 1357615-55-4) is a chemical compound with the molecular formula C9H8F3N and a molecular weight of 187.16 g/mol. IUPAC name: 2-[(E)-3,3,3-trifluoroprop-1-enyl]aniline. InChIKey: KTNTYJRDRBDXIR-AATRIKPKSA-N.
| Molecular formula | C9H8F3N |
|---|---|
| Molecular weight | 187.16 g/mol |
| IUPAC name | 2-[(E)-3,3,3-trifluoroprop-1-enyl]aniline |
| InChIKey | KTNTYJRDRBDXIR-AATRIKPKSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C(F)(F)F)N |
Computed by PubChem (NCBI)