CAS 1997-85-9 is the registry number for Benzyl(2,2,2-trifluoroethylidene)amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-benzyl-2,2,2-trifluoroethanimine (CAS 1997-85-9) is a chemical compound with the molecular formula C9H8F3N and a molecular weight of 187.16 g/mol. IUPAC name: N-benzyl-2,2,2-trifluoroethanimine. InChIKey: SVXVQGHKZKUEIS-UHFFFAOYSA-N.
| Molecular formula | C9H8F3N |
|---|---|
| Molecular weight | 187.16 g/mol |
| IUPAC name | N-benzyl-2,2,2-trifluoroethanimine |
| InChIKey | SVXVQGHKZKUEIS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN=CC(F)(F)F |
Computed by PubChem (NCBI)