CAS 1365988-04-0 is the registry number for 2-(Trifluoromethyl)indoline, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-(trifluoromethyl)-2,3-dihydro-1H-indole (CAS 1365988-04-0) is a chemical compound with the molecular formula C9H8F3N and a molecular weight of 187.16 g/mol. IUPAC name: 2-(trifluoromethyl)-2,3-dihydro-1H-indole. InChIKey: ZBCLMTMXGXNCIR-UHFFFAOYSA-N.
| Molecular formula | C9H8F3N |
|---|---|
| Molecular weight | 187.16 g/mol |
| IUPAC name | 2-(trifluoromethyl)-2,3-dihydro-1H-indole |
| InChIKey | ZBCLMTMXGXNCIR-UHFFFAOYSA-N |
| SMILES | C1C(NC2=CC=CC=C21)C(F)(F)F |
Computed by PubChem (NCBI)