CAS 2166899-58-5 is the registry number for 4-(Trifluoromethyl)-Cuban-1-Amine. Offered by: Chemat Brand. Available pack sizes: on request.
4-(trifluoromethyl)cuban-1-amine (CAS 2166899-58-5) is a chemical compound with the molecular formula C9H8F3N and a molecular weight of 187.16 g/mol. IUPAC name: 4-(trifluoromethyl)cuban-1-amine. InChIKey: VOPAOTFGXAIWSB-UHFFFAOYSA-N.
| Molecular formula | C9H8F3N |
|---|---|
| Molecular weight | 187.16 g/mol |
| IUPAC name | 4-(trifluoromethyl)cuban-1-amine |
| InChIKey | VOPAOTFGXAIWSB-UHFFFAOYSA-N |
| SMILES | C12C3C4C1(C5C2C3(C45)N)C(F)(F)F |
Computed by PubChem (NCBI)