CAS 342638-03-3 appears in our catalog under these names: 5-(Trifluoromethyl)isoindoline, 95+%, 5-(Trifluoromethyl)isoindoline. Offered by: AmBeed, TRC. Available pack sizes: 1g, 750mg.
5-(trifluoromethyl)-2,3-dihydro-1H-isoindole (CAS 342638-03-3) is a chemical compound with the molecular formula C9H8F3N and a molecular weight of 187.16 g/mol. IUPAC name: 5-(trifluoromethyl)-2,3-dihydro-1H-isoindole. InChIKey: MLGLDTHUKQAQEC-UHFFFAOYSA-N.
| Molecular formula | C9H8F3N |
|---|---|
| Molecular weight | 187.16 g/mol |
| IUPAC name | 5-(trifluoromethyl)-2,3-dihydro-1H-isoindole |
| InChIKey | MLGLDTHUKQAQEC-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)C=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)