CAS 1358604-08-6 is the registry number for Empagliflozin Impurity 130. Offered by: Chemat Brand. Available pack sizes: on request.
[(3R)-oxolan-3-yl] 4-nitrobenzoate (CAS 1358604-08-6) is a chemical compound with the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. IUPAC name: [(3R)-oxolan-3-yl] 4-nitrobenzoate. InChIKey: UMUYAUZIMSRRLR-SNVBAGLBSA-N.
| Molecular formula | C11H11NO5 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | [(3R)-oxolan-3-yl] 4-nitrobenzoate |
| InChIKey | UMUYAUZIMSRRLR-SNVBAGLBSA-N |
| SMILES | C1COC[C@@H]1OC(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)