CAS 135944-05-7 appears in our catalog under these names: Fmoc-a-methyl-L-phenylalanine, >95% (HPLC), Fmoc–α–Me–Phe–OH, Fmoc-alpha-Me-L-Phe-OH, Fmoc-α-methyl-L-phenylalanine, Fmoc-α-Me-Phe-OH 95%. Offered by: TRC, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 100g, 50g, 100mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-3-phenylpropanoic acid (CAS 135944-05-7) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-3-phenylpropanoic acid. InChIKey: KLBKBAAOPOXFSK-VWLOTQADSA-N.
| Molecular formula | C25H23NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-3-phenylpropanoic acid |
| InChIKey | KLBKBAAOPOXFSK-VWLOTQADSA-N |
| SMILES | C[C@](CC1=CC=CC=C1)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)