Products 1359978-55-4
CAS 1359978-55-4 is the registry number for Caulophylline B. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
1-[2-(dimethylamino)ethyl]-4,5-dihydroxy-3,6-dimethoxyfluoren-9-one (CAS 1359978-55-4) is a chemical compound with the molecular formula C19H21NO5 and a molecular weight of 343.4 g/mol. IUPAC name: 1-[2-(dimethylamino)ethyl]-4,5-dihydroxy-3,6-dimethoxyfluoren-9-one. InChIKey: NAQHNUUPLJAHRT-UHFFFAOYSA-N.
| Molecular formula | C19H21NO5 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | 1-[2-(dimethylamino)ethyl]-4,5-dihydroxy-3,6-dimethoxyfluoren-9-one |
| InChIKey | NAQHNUUPLJAHRT-UHFFFAOYSA-N |
| SMILES | CN(C)CCC1=CC(=C(C2=C1C(=O)C3=C2C(=C(C=C3)OC)O)O)OC |
Computed by PubChem (NCBI)