Products 136056-01-4
CAS 136056-01-4 is the registry number for L-Phenylalanine-α-13C, ≥99 atom% 13C,≥97%, ≥99 atom% 13C,≥97%. Offered by: Chemat. Available pack sizes: 5mg, 25mg.
(2S)-2-amino-3-phenyl(213C)propanoic acid (CAS 136056-01-4) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 166.18 g/mol. IUPAC name: (2S)-2-amino-3-phenyl(213C)propanoic acid. InChIKey: COLNVLDHVKWLRT-IDMPRHEVSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | (2S)-2-amino-3-phenyl(213C)propanoic acid |
| InChIKey | COLNVLDHVKWLRT-IDMPRHEVSA-N |
| SMILES | C1=CC=C(C=C1)C[13C@@H](C(=O)O)N |
Computed by PubChem (NCBI)