Products 136056-02-5
CAS 136056-02-5 appears in our catalog under these names: L–Phenylalanine–3–13C, L-PHENYLALANINE-BETA-13C, 99 ATOM % 13C, L-Phenylalanine-3-13C, 99.56%, L-Phenylalanine-3-13C, 99%, 99%. Offered by: GLPBio, Sigma-Aldrich, MedChemExpress, Chemat. Available pack sizes: 5mg, 10mg, 100MG, 10 mg, 5 mg.
(2S)-2-amino-3-phenyl(313C)propanoic acid (CAS 136056-02-5) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 166.18 g/mol. IUPAC name: (2S)-2-amino-3-phenyl(313C)propanoic acid. InChIKey: COLNVLDHVKWLRT-JCNVXSMLSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | (2S)-2-amino-3-phenyl(313C)propanoic acid |
| InChIKey | COLNVLDHVKWLRT-JCNVXSMLSA-N |
| SMILES | C1=CC=C(C=C1)[13CH2][C@@H](C(=O)O)N |
Computed by PubChem (NCBI)