CAS 136068-43-4 appears in our catalog under these names: Antioxidant agent–1, Antioxidant agent-1, 98%, 98%, Antioxidant agent-1, 98.13%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 1mg, 10mM/1mL, 50 mg.
(E)-3-(3,4-dihydroxyphenyl)-1-phenylprop-2-en-1-one (CAS 136068-43-4) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: (E)-3-(3,4-dihydroxyphenyl)-1-phenylprop-2-en-1-one. InChIKey: HHKVOYUYPYZFHJ-SOFGYWHQSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | (E)-3-(3,4-dihydroxyphenyl)-1-phenylprop-2-en-1-one |
| InChIKey | HHKVOYUYPYZFHJ-SOFGYWHQSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)/C=C/C2=CC(=C(C=C2)O)O |
Computed by PubChem (NCBI)