CAS 72704-76-8 appears in our catalog under these names: 3,4-Dihydroxychalcone, 95%, 3,4-Dihydroxychalcone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 50mg.
3-(3,4-dihydroxyphenyl)-1-phenylprop-2-en-1-one (CAS 72704-76-8) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: 3-(3,4-dihydroxyphenyl)-1-phenylprop-2-en-1-one. InChIKey: HHKVOYUYPYZFHJ-UHFFFAOYSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 3-(3,4-dihydroxyphenyl)-1-phenylprop-2-en-1-one |
| InChIKey | HHKVOYUYPYZFHJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C=CC2=CC(=C(C=C2)O)O |
Computed by PubChem (NCBI)