Products 136083-93-7
CAS 136083-93-7 appears in our catalog under these names: Onjixanthone II, Onjixanthone II. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
1,3,6-trihydroxy-2,7-dimethoxyxanthen-9-one (CAS 136083-93-7) is a chemical compound with the molecular formula C15H12O7 and a molecular weight of 304.25 g/mol. IUPAC name: 1,3,6-trihydroxy-2,7-dimethoxyxanthen-9-one. InChIKey: MEDZADGBRDMLGM-UHFFFAOYSA-N.
| Molecular formula | C15H12O7 |
|---|---|
| Molecular weight | 304.25 g/mol |
| IUPAC name | 1,3,6-trihydroxy-2,7-dimethoxyxanthen-9-one |
| InChIKey | MEDZADGBRDMLGM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)C3=C(O2)C=C(C(=C3O)OC)O)O |
Computed by PubChem (NCBI)