CAS 5042-09-1 appears in our catalog under these names: Corymbiferin, Corymbiferin, 98%, Corymbiferin, ≥98%, ≥98%. Offered by: TRC, AmBeed, Chemat, MedChemExpress. Available pack sizes: 25mg, 5mg, 10mg, 1 mg, 5 mg, 10 mg.
1,3,8-trihydroxy-4,5-dimethoxyxanthen-9-one (CAS 5042-09-1) is a chemical compound with the molecular formula C15H12O7 and a molecular weight of 304.25 g/mol. IUPAC name: 1,3,8-trihydroxy-4,5-dimethoxyxanthen-9-one. InChIKey: MXKGQHAVANZONW-UHFFFAOYSA-N.
| Molecular formula | C15H12O7 |
|---|---|
| Molecular weight | 304.25 g/mol |
| IUPAC name | 1,3,8-trihydroxy-4,5-dimethoxyxanthen-9-one |
| InChIKey | MXKGQHAVANZONW-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)O)C(=O)C3=C(O2)C(=C(C=C3O)O)OC |
Computed by PubChem (NCBI)