Products 345287-92-5
CAS 345287-92-5 appears in our catalog under these names: 1，3，6–Trihydroxy–2，5–dimethoxyxanthone, 1,3,6-Trihydroxy-2,5-dimethoxyxanthone. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, Get quote.
1,3,6-trihydroxy-2,5-dimethoxyxanthen-9-one (CAS 345287-92-5) is a chemical compound with the molecular formula C15H12O7 and a molecular weight of 304.25 g/mol. IUPAC name: 1,3,6-trihydroxy-2,5-dimethoxyxanthen-9-one. InChIKey: YAPFVXIBUYNNQM-UHFFFAOYSA-N.
| Molecular formula | C15H12O7 |
|---|---|
| Molecular weight | 304.25 g/mol |
| IUPAC name | 1,3,6-trihydroxy-2,5-dimethoxyxanthen-9-one |
| InChIKey | YAPFVXIBUYNNQM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC2=C1OC3=C(C2=O)C(=C(C(=C3)O)OC)O)O |
Computed by PubChem (NCBI)