CAS 80366-15-0 appears in our catalog under these names: 3,5,7,2',6'-Pentahydroxyflavanone, 2',3,5,6',7-Pentahydroxyflavanone, 2′,3,5,6′,7-Pentahydroxyflavanone. Offered by: TRC, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 5 mg, 1 mg, 10 mg.
(2R,3R)-2-(2,6-dihydroxyphenyl)-3,5,7-trihydroxy-2,3-dihydrochromen-4-one (CAS 80366-15-0) is a chemical compound with the molecular formula C15H12O7 and a molecular weight of 304.25 g/mol. IUPAC name: (2R,3R)-2-(2,6-dihydroxyphenyl)-3,5,7-trihydroxy-2,3-dihydrochromen-4-one. InChIKey: NBQYBZYBTNQEQG-LSDHHAIUSA-N.
| Molecular formula | C15H12O7 |
|---|---|
| Molecular weight | 304.25 g/mol |
| IUPAC name | (2R,3R)-2-(2,6-dihydroxyphenyl)-3,5,7-trihydroxy-2,3-dihydrochromen-4-one |
| InChIKey | NBQYBZYBTNQEQG-LSDHHAIUSA-N |
| SMILES | C1=CC(=C(C(=C1)O)[C@@H]2[C@H](C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
Computed by PubChem (NCBI)