Products 65008-02-8
CAS 65008-02-8 appears in our catalog under these names: 1，5，6–Trihydroxy–3，7–dimethoxyxanthone, 1,5,6-Trihydroxy-3,7-dimethoxyxanthone. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
1,5,6-trihydroxy-3,7-dimethoxyxanthen-9-one (CAS 65008-02-8) is a chemical compound with the molecular formula C15H12O7 and a molecular weight of 304.25 g/mol. IUPAC name: 1,5,6-trihydroxy-3,7-dimethoxyxanthen-9-one. InChIKey: UBCXIVCXMABZNZ-UHFFFAOYSA-N.
| Molecular formula | C15H12O7 |
|---|---|
| Molecular weight | 304.25 g/mol |
| IUPAC name | 1,5,6-trihydroxy-3,7-dimethoxyxanthen-9-one |
| InChIKey | UBCXIVCXMABZNZ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=C1)OC3=C(C(=C(C=C3C2=O)OC)O)O)O |
Computed by PubChem (NCBI)