CAS 177659-77-7 appears in our catalog under these names: Boc-n-methyl-d-norvaline, 95%, (R)-2-((tert-Butoxycarbonyl)(methyl)amino)pentanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid (CAS 177659-77-7) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: (2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid. InChIKey: BSMXBPUTGXWAGA-MRVPVSSYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid |
| InChIKey | BSMXBPUTGXWAGA-MRVPVSSYSA-N |
| SMILES | CCC[C@H](C(=O)O)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)