Products 1360955-31-2

CAS 1360955-31-2 is the registry number for 7-Methoxy-2-methyl-5-nitro-1H-indole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

7-methoxy-2-methyl-5-nitro-1H-indole-3-carboxylic acid (CAS 1360955-31-2) is a chemical compound with the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. IUPAC name: 7-methoxy-2-methyl-5-nitro-1H-indole-3-carboxylic acid. InChIKey: SBKJYHSFMWCOEX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N2O5
Molecular weight250.21 g/mol
IUPAC name7-methoxy-2-methyl-5-nitro-1H-indole-3-carboxylic acid
InChIKeySBKJYHSFMWCOEX-UHFFFAOYSA-N
SMILESCC1=C(C2=C(N1)C(=CC(=C2)[N+](=O)[O-])OC)C(=O)O

Computed by PubChem (NCBI)