Products 345297-65-6

CAS 345297-65-6 is the registry number for 1-(3-Nitrophenyl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

1-(3-nitrophenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 345297-65-6) is a chemical compound with the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. IUPAC name: 1-(3-nitrophenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: HKWNCNVBEVINPC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N2O5
Molecular weight250.21 g/mol
IUPAC name1-(3-nitrophenyl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyHKWNCNVBEVINPC-UHFFFAOYSA-N
SMILESC1C(CN(C1=O)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)