CAS 296265-27-5 is the registry number for 4-(2-(4-Hydroxybenzoyl)hydrazinyl)-4-oxobut-2-enoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-4-[2-(4-hydroxybenzoyl)hydrazinyl]-4-oxobut-2-enoic acid (CAS 296265-27-5) is a chemical compound with the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. IUPAC name: (E)-4-[2-(4-hydroxybenzoyl)hydrazinyl]-4-oxobut-2-enoic acid. InChIKey: JUJOILVOYUHPOL-AATRIKPKSA-N.
| Molecular formula | C11H10N2O5 |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | (E)-4-[2-(4-hydroxybenzoyl)hydrazinyl]-4-oxobut-2-enoic acid |
| InChIKey | JUJOILVOYUHPOL-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NNC(=O)/C=C/C(=O)O)O |
Computed by PubChem (NCBI)