CAS 143815-49-0 is the registry number for 2-Propenoic acid, 2-(acetylamino)-3-(3-nitrophenyl)-, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-acetamido-3-(3-nitrophenyl)prop-2-enoic acid (CAS 143815-49-0) is a chemical compound with the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. IUPAC name: 2-acetamido-3-(3-nitrophenyl)prop-2-enoic acid. InChIKey: PABMJKZMUOMZOR-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O5 |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | 2-acetamido-3-(3-nitrophenyl)prop-2-enoic acid |
| InChIKey | PABMJKZMUOMZOR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(=CC1=CC(=CC=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)