CAS 1432752-16-3 is the registry number for 6,7-Dimethoxy-4-oxo-3,4-dihydrophthalazine-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dimethoxy-4-oxo-3H-phthalazine-1-carboxylic acid (CAS 1432752-16-3) is a chemical compound with the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. IUPAC name: 6,7-dimethoxy-4-oxo-3H-phthalazine-1-carboxylic acid. InChIKey: YMEBCCOWNZZDIO-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O5 |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | 6,7-dimethoxy-4-oxo-3H-phthalazine-1-carboxylic acid |
| InChIKey | YMEBCCOWNZZDIO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NNC2=O)C(=O)O)OC |
Computed by PubChem (NCBI)