Products 1432752-16-3

CAS 1432752-16-3 is the registry number for 6,7-Dimethoxy-4-oxo-3,4-dihydrophthalazine-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6,7-dimethoxy-4-oxo-3H-phthalazine-1-carboxylic acid (CAS 1432752-16-3) is a chemical compound with the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. IUPAC name: 6,7-dimethoxy-4-oxo-3H-phthalazine-1-carboxylic acid. InChIKey: YMEBCCOWNZZDIO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N2O5
Molecular weight250.21 g/mol
IUPAC name6,7-dimethoxy-4-oxo-3H-phthalazine-1-carboxylic acid
InChIKeyYMEBCCOWNZZDIO-UHFFFAOYSA-N
SMILESCOC1=C(C=C2C(=C1)C(=NNC2=O)C(=O)O)OC

Computed by PubChem (NCBI)