CAS 1361017-74-4 appears in our catalog under these names: Carbidopa EP Impurity H, (2S)-2-Hydrazino-3-(3-hydroxy-4-methoxyphenyl)-2-methylpropanoic Acid, Carbidopa Impurity 2, (2S)-2-Hydrazino-3-(3-hydroxy-4-methoxyphenyl)-2-methylpropanoic Acid, 95%, 95%. Offered by: Chemat Brand, TRC, Biosynth, Chemat. Available pack sizes: on request, 75mg, 1mg, 2mg, 5mg, 25mg, 10mg.
(2S)-2-hydrazinyl-3-(3-hydroxy-4-methoxyphenyl)-2-methylpropanoic acid (CAS 1361017-74-4) is a chemical compound with the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. IUPAC name: (2S)-2-hydrazinyl-3-(3-hydroxy-4-methoxyphenyl)-2-methylpropanoic acid. InChIKey: ZNEMNEYYTAHRJU-NSHDSACASA-N.
| Molecular formula | C11H16N2O4 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | (2S)-2-hydrazinyl-3-(3-hydroxy-4-methoxyphenyl)-2-methylpropanoic acid |
| InChIKey | ZNEMNEYYTAHRJU-NSHDSACASA-N |
| SMILES | C[C@](CC1=CC(=C(C=C1)OC)O)(C(=O)O)NN |
Computed by PubChem (NCBI)