Products 1361681-07-3
CAS 1361681-07-3 is the registry number for 8-Deoxylactucin, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-amino-5-(trifluoromethoxy)-1H-pyridin-2-one (CAS 1361681-07-3) is a chemical compound with the molecular formula C6H5F3N2O2 and a molecular weight of 194.11 g/mol. IUPAC name: 4-amino-5-(trifluoromethoxy)-1H-pyridin-2-one. InChIKey: JRGWDEWQGYYFJE-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O2 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 4-amino-5-(trifluoromethoxy)-1H-pyridin-2-one |
| InChIKey | JRGWDEWQGYYFJE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CNC1=O)OC(F)(F)F)N |
Computed by PubChem (NCBI)