CAS 1361890-39-2 is the registry number for 2-Chloro-5-(trifluoromethoxy)pyridin-4-amine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-5-(trifluoromethoxy)pyridin-4-amine (CAS 1361890-39-2) is a chemical compound with the molecular formula C6H4ClF3N2O and a molecular weight of 212.56 g/mol. IUPAC name: 2-chloro-5-(trifluoromethoxy)pyridin-4-amine. InChIKey: ABXRSIIWRAWMOW-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N2O |
|---|---|
| Molecular weight | 212.56 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethoxy)pyridin-4-amine |
| InChIKey | ABXRSIIWRAWMOW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)OC(F)(F)F)N |
Computed by PubChem (NCBI)