CAS 136247-72-8 is the registry number for (-)-Horsfiline. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 5mg, 1mg, 10mg, 50mg.
(3R)-5-methoxy-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one (CAS 136247-72-8) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: (3R)-5-methoxy-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one. InChIKey: RVOLLKGLJIUGLG-ZDUSSCGKSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | (3R)-5-methoxy-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
| InChIKey | RVOLLKGLJIUGLG-ZDUSSCGKSA-N |
| SMILES | CN1CC[C@]2(C1)C3=C(C=CC(=C3)OC)NC2=O |
Computed by PubChem (NCBI)