CAS 13631-92-0 appears in our catalog under these names: Diethyl 2-(2-(2-nitrophenyl)hydrazono)malonate, 95+%, 1,3-Diethyl 2-(2-(2-nitrophenyl)hydrazin-1-ylidene)propanedioate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Diethyl 2-[(2-nitrophenyl)hydrazinylidene]propanedioate (CAS 13631-92-0) is a chemical compound with the molecular formula C13H15N3O6 and a molecular weight of 309.27 g/mol. IUPAC name: diethyl 2-[(2-nitrophenyl)hydrazinylidene]propanedioate. InChIKey: AXKOQCFOAAOZIU-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O6 |
|---|---|
| Molecular weight | 309.27 g/mol |
| IUPAC name | diethyl 2-[(2-nitrophenyl)hydrazinylidene]propanedioate |
| InChIKey | AXKOQCFOAAOZIU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=NNC1=CC=CC=C1[N+](=O)[O-])C(=O)OCC |
Computed by PubChem (NCBI)