CAS 1696408-88-4 is the registry number for H-L-Asp(MNI)-OH. Offered by: Iris Biotech. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-amino-4-(4-methoxy-7-nitro-2,3-dihydroindol-1-yl)-4-oxobutanoic acid (CAS 1696408-88-4) is a chemical compound with the molecular formula C13H15N3O6 and a molecular weight of 309.27 g/mol. IUPAC name: (2S)-2-amino-4-(4-methoxy-7-nitro-2,3-dihydroindol-1-yl)-4-oxobutanoic acid. InChIKey: ATNVWKDWOLQDKH-QMMMGPOBSA-N.
| Molecular formula | C13H15N3O6 |
|---|---|
| Molecular weight | 309.27 g/mol |
| IUPAC name | (2S)-2-amino-4-(4-methoxy-7-nitro-2,3-dihydroindol-1-yl)-4-oxobutanoic acid |
| InChIKey | ATNVWKDWOLQDKH-QMMMGPOBSA-N |
| SMILES | COC1=C2CCN(C2=C(C=C1)[N+](=O)[O-])C(=O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)