CAS 136378-34-2 is the registry number for (1S,2S)-1-((tert-Butoxycarbonyl)amino)-2-ethylcyclopropane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1S,2S)-2-ethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid (CAS 136378-34-2) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: trans-(1S,2S)-2-ethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid. InChIKey: QUJJZDFGKLKCJR-CPCISQLKSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | trans-(1S,2S)-2-ethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid |
| InChIKey | QUJJZDFGKLKCJR-CPCISQLKSA-N |
| SMILES | CC[C@H]1C[C@]1(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)