CAS 159700-60-4 is the registry number for (1R,2R)-1-((tert-Butoxycarbonyl)amino)-2-ethylcyclopropane-1-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-2-ethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid (CAS 159700-60-4) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: (1R)-2-ethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid. InChIKey: QUJJZDFGKLKCJR-PLNQYNMKSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (1R)-2-ethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid |
| InChIKey | QUJJZDFGKLKCJR-PLNQYNMKSA-N |
| SMILES | CCC1C[C@@]1(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)