CAS 401514-70-3 appears in our catalog under these names: Fmoc–3–(2–quinolyl)–DL–Ala–OH, Fmoc-3-(2-quinolyl)-DL-Ala-OH, 95%, Fmoc-3-(2-quinolyl)-DL-Ala-OH, 95%, 95%. Offered by: GLPBio, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 50mg, 10mg.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-quinolin-2-ylpropanoic acid (CAS 401514-70-3) is a chemical compound with the molecular formula C27H22N2O4 and a molecular weight of 438.5 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-quinolin-2-ylpropanoic acid. InChIKey: IDOMHXAHHXHYMO-UHFFFAOYSA-N.
| Molecular formula | C27H22N2O4 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-quinolin-2-ylpropanoic acid |
| InChIKey | IDOMHXAHHXHYMO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)CC(C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)