CAS 1365271-38-0 is the registry number for 2-(3,4-Dimethoxyphenyl)-6-ethyl-3-hydroxychromen-4-one, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(3,4-dimethoxyphenyl)-6-ethyl-3-hydroxychromen-4-one (CAS 1365271-38-0) is a chemical compound with the molecular formula C19H18O5 and a molecular weight of 326.3 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-6-ethyl-3-hydroxychromen-4-one. InChIKey: YKHMBQJWXCDRGE-UHFFFAOYSA-N.
| Molecular formula | C19H18O5 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-6-ethyl-3-hydroxychromen-4-one |
| InChIKey | YKHMBQJWXCDRGE-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)OC(=C(C2=O)O)C3=CC(=C(C=C3)OC)OC |
Computed by PubChem (NCBI)