Products 57696-12-5

CAS 57696-12-5 is the registry number for Ethyl 4-(4-benzyloxyphenyl)-2,4-dioxobutanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2,4-dioxo-4-(4-phenylmethoxyphenyl)butanoate (CAS 57696-12-5) is a chemical compound with the molecular formula C19H18O5 and a molecular weight of 326.3 g/mol. IUPAC name: ethyl 2,4-dioxo-4-(4-phenylmethoxyphenyl)butanoate. InChIKey: BTUJZIGPAGODTR-UHFFFAOYSA-N.

Identity
Molecular formulaC19H18O5
Molecular weight326.3 g/mol
IUPAC nameethyl 2,4-dioxo-4-(4-phenylmethoxyphenyl)butanoate
InChIKeyBTUJZIGPAGODTR-UHFFFAOYSA-N
SMILESCCOC(=O)C(=O)CC(=O)C1=CC=C(C=C1)OCC2=CC=CC=C2

Computed by PubChem (NCBI)