Products 156398-61-7
CAS 156398-61-7 is the registry number for Ailanthoidol. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 2mg, 1mg, Get quote.
4-[5-[(E)-3-hydroxyprop-1-enyl]-7-methoxy-1-benzofuran-2-yl]-2-methoxyphenol (CAS 156398-61-7) is a chemical compound with the molecular formula C19H18O5 and a molecular weight of 326.3 g/mol. IUPAC name: 4-[5-[(E)-3-hydroxyprop-1-enyl]-7-methoxy-1-benzofuran-2-yl]-2-methoxyphenol. InChIKey: ZDQCRQVGMKIBPN-ONEGZZNKSA-N.
| Molecular formula | C19H18O5 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | 4-[5-[(E)-3-hydroxyprop-1-enyl]-7-methoxy-1-benzofuran-2-yl]-2-methoxyphenol |
| InChIKey | ZDQCRQVGMKIBPN-ONEGZZNKSA-N |
| SMILES | COC1=CC(=CC2=C1OC(=C2)C3=CC(=C(C=C3)O)OC)/C=C/CO |
Computed by PubChem (NCBI)