Products 36587-59-4
CAS 36587-59-4 is the registry number for Unguinol. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg, 1 mg.
1-[(E)-but-2-en-2-yl]-3,9-dihydroxy-4,7-dimethylbenzo[b][1,4]benzodioxepin-6-one (CAS 36587-59-4) is a chemical compound with the molecular formula C19H18O5 and a molecular weight of 326.3 g/mol. IUPAC name: 1-[(E)-but-2-en-2-yl]-3,9-dihydroxy-4,7-dimethylbenzo[b][1,4]benzodioxepin-6-one. InChIKey: ZPPIKBUIYSSQEH-WEVVVXLNSA-N.
| Molecular formula | C19H18O5 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | 1-[(E)-but-2-en-2-yl]-3,9-dihydroxy-4,7-dimethylbenzo[b][1,4]benzodioxepin-6-one |
| InChIKey | ZPPIKBUIYSSQEH-WEVVVXLNSA-N |
| SMILES | C/C=C(\C)/C1=CC(=C(C2=C1OC3=C(C(=CC(=C3)O)C)C(=O)O2)C)O |
Computed by PubChem (NCBI)