CAS 720674-23-7 is the registry number for 3-(3’,4’-Dimethoxyphenyl)-7-methoxy-4-methylcoumarin, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,4-dimethoxyphenyl)-7-methoxy-4-methylchromen-2-one (CAS 720674-23-7) is a chemical compound with the molecular formula C19H18O5 and a molecular weight of 326.3 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)-7-methoxy-4-methylchromen-2-one. InChIKey: GPDCGNOQPXVFPO-UHFFFAOYSA-N.
| Molecular formula | C19H18O5 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)-7-methoxy-4-methylchromen-2-one |
| InChIKey | GPDCGNOQPXVFPO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C1C=CC(=C2)OC)C3=CC(=C(C=C3)OC)OC |
Computed by PubChem (NCBI)