CAS 1365763-73-0 is the registry number for 7-Chloro-6-methoxy-1,2,3,4-tetrahydroisoquinolin-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-chloro-6-methoxy-3,4-dihydro-2H-isoquinolin-1-one (CAS 1365763-73-0) is a chemical compound with the molecular formula C10H10ClNO2 and a molecular weight of 211.64 g/mol. IUPAC name: 7-chloro-6-methoxy-3,4-dihydro-2H-isoquinolin-1-one. InChIKey: NDSYRVHJEULFPN-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO2 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | 7-chloro-6-methoxy-3,4-dihydro-2H-isoquinolin-1-one |
| InChIKey | NDSYRVHJEULFPN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CCNC2=O)Cl |
Computed by PubChem (NCBI)