CAS 2043322-62-7 is the registry number for (S)-2-(3-Oxo-1,2,3,4-tetrahydroquinoxalin-2-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2S)-3-oxo-2,4-dihydro-1H-quinoxalin-2-yl]acetic acid (CAS 2043322-62-7) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: 2-[(2S)-3-oxo-2,4-dihydro-1H-quinoxalin-2-yl]acetic acid. InChIKey: UCNFCRXGPQHQBE-QMMMGPOBSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | 2-[(2S)-3-oxo-2,4-dihydro-1H-quinoxalin-2-yl]acetic acid |
| InChIKey | UCNFCRXGPQHQBE-QMMMGPOBSA-N |
| SMILES | C1=CC=C2C(=C1)N[C@H](C(=O)N2)CC(=O)O |
Computed by PubChem (NCBI)