CAS 136630-36-9 appears in our catalog under these names: 4,4'–Dibromo–(1,1'–biphenyl)–2,2'–diamine, 4,4'-Dibromo-[1,1'-biphenyl]-2,2'-diamine 97%, 4,4'-DIBROMO-2,2'-BIPHENYLDIAMINE, 4,4'-Dibromo-[1,1'-biphenyl]-2,2'-diamine, 95%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 250mg, 100g.
2-(2-amino-4-bromophenyl)-5-bromoaniline (CAS 136630-36-9) is a chemical compound with the molecular formula C12H10Br2N2 and a molecular weight of 342.03 g/mol. IUPAC name: 2-(2-amino-4-bromophenyl)-5-bromoaniline. InChIKey: KZDMFBDNQPKWNM-UHFFFAOYSA-N.
| Molecular formula | C12H10Br2N2 |
|---|---|
| Molecular weight | 342.03 g/mol |
| IUPAC name | 2-(2-amino-4-bromophenyl)-5-bromoaniline |
| InChIKey | KZDMFBDNQPKWNM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)N)C2=C(C=C(C=C2)Br)N |
Computed by PubChem (NCBI)