CAS 34237-98-4 appears in our catalog under these names: 3,3'-Dibromo-[1,1'-biphenyl]-4,4'-diamine, 98%, 3,3'-Dibromo-[1,1'-biphenyl]-4,4'-diamine 97%, 3,3'-Dibromo-[1,1'-biphenyl]-4,4'-diamine, 97%, 97%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(4-amino-3-bromophenyl)-2-bromoaniline (CAS 34237-98-4) is a chemical compound with the molecular formula C12H10Br2N2 and a molecular weight of 342.03 g/mol. IUPAC name: 4-(4-amino-3-bromophenyl)-2-bromoaniline. InChIKey: QWUSZGIKGARVEC-UHFFFAOYSA-N.
| Molecular formula | C12H10Br2N2 |
|---|---|
| Molecular weight | 342.03 g/mol |
| IUPAC name | 4-(4-amino-3-bromophenyl)-2-bromoaniline |
| InChIKey | QWUSZGIKGARVEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)N)Br)Br)N |
Computed by PubChem (NCBI)