CAS 92642-09-6 appears in our catalog under these names: 5,5'–Bis(bromomethyl)–2,2'–bipyridine, 5,5'-Bis(bromomethyl)-2,2'-bipyridine 97%, 5,5'-BIS(BROMOMETHYL)-2,2'-BIPYRIDINE, 95%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
5-(bromomethyl)-2-[5-(bromomethyl)-2-pyridinyl]pyridine (CAS 92642-09-6) is a chemical compound with the molecular formula C12H10Br2N2 and a molecular weight of 342.03 g/mol. IUPAC name: 5-(bromomethyl)-2-[5-(bromomethyl)-2-pyridinyl]pyridine. InChIKey: OESAKGGTMNBXLT-UHFFFAOYSA-N.
| Molecular formula | C12H10Br2N2 |
|---|---|
| Molecular weight | 342.03 g/mol |
| IUPAC name | 5-(bromomethyl)-2-[5-(bromomethyl)-2-pyridinyl]pyridine |
| InChIKey | OESAKGGTMNBXLT-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1CBr)C2=NC=C(C=C2)CBr |
Computed by PubChem (NCBI)