CAS 84530-60-9 appears in our catalog under these names: 4,4'-Diamino-2,2'-dibromobiphenyl, 95%, 4,4’–Diamino–2,2’–dibromobiphenyl, 4,4'-Diamino-2,2'-dibromobiphenyl, 98%, 98%, 4,4'-Diamino-2,2'-dibromobiphenyl, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
4-(4-amino-2-bromophenyl)-3-bromoaniline (CAS 84530-60-9) is a chemical compound with the molecular formula C12H10Br2N2 and a molecular weight of 342.03 g/mol. IUPAC name: 4-(4-amino-2-bromophenyl)-3-bromoaniline. InChIKey: CPBGOWIFSRZWIZ-UHFFFAOYSA-N.
| Molecular formula | C12H10Br2N2 |
|---|---|
| Molecular weight | 342.03 g/mol |
| IUPAC name | 4-(4-amino-2-bromophenyl)-3-bromoaniline |
| InChIKey | CPBGOWIFSRZWIZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)Br)C2=C(C=C(C=C2)N)Br |
Computed by PubChem (NCBI)