CAS 51951-92-9 is the registry number for 2,2'-Dibromo-5,5'-diaminobiphenyl. Offered by: TRC. Available pack sizes: 500mg.
3-(5-amino-2-bromophenyl)-4-bromoaniline (CAS 51951-92-9) is a chemical compound with the molecular formula C12H10Br2N2 and a molecular weight of 342.03 g/mol. IUPAC name: 3-(5-amino-2-bromophenyl)-4-bromoaniline. InChIKey: HIEHVYFHYOUYLC-UHFFFAOYSA-N.
| Molecular formula | C12H10Br2N2 |
|---|---|
| Molecular weight | 342.03 g/mol |
| IUPAC name | 3-(5-amino-2-bromophenyl)-4-bromoaniline |
| InChIKey | HIEHVYFHYOUYLC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C2=C(C=CC(=C2)N)Br)Br |
Computed by PubChem (NCBI)