CAS 13664-92-1 is the registry number for Raloxifene Impurity 25. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dibromo-1-(4-methoxyphenyl)ethanone (CAS 13664-92-1) is a chemical compound with the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. IUPAC name: 2,2-dibromo-1-(4-methoxyphenyl)ethanone. InChIKey: WZCPFTTUVDBPOG-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O2 |
|---|---|
| Molecular weight | 307.97 g/mol |
| IUPAC name | 2,2-dibromo-1-(4-methoxyphenyl)ethanone |
| InChIKey | WZCPFTTUVDBPOG-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C(Br)Br |
Computed by PubChem (NCBI)