Products 136645-25-5
CAS 136645-25-5 appears in our catalog under these names: 3-(Bromomethyl)phenoxyacetic acid, 95%, 3-(Bromomethyl)phenoxyacetic acid, 97% , 3-(Bromomethyl)phenoxyacetic acid, 2-[3-(bromomethyl)phenoxy]acetic acid, ≥97%, ≥97%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 200mg.
2-[3-(bromomethyl)phenoxy]acetic acid (CAS 136645-25-5) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 2-[3-(bromomethyl)phenoxy]acetic acid. InChIKey: MSTODKGDFXWAIO-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 2-[3-(bromomethyl)phenoxy]acetic acid |
| InChIKey | MSTODKGDFXWAIO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)O)CBr |
Computed by PubChem (NCBI)